C22H29N5O2S — CID 111813424
1-(2,3-dihydro-1H-inden-5-yl)-2-[[2-(4-methylpiperazin-1-yl)sulfonylphenyl]methyl]guanidine (PubChem CID 111813424) has the molecular formula C22H29N5O2S and a molecular weight of 427.57 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-2-[[2-(4-methylpiperazin-1-yl)sulfonylphenyl]methyl]guanidine.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[[2-(4-methylpiperazin-1-yl)sulfonylphenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111813424 |
| Molecular Formula | C22H29N5O2S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[[2-(4-methylpiperazin-1-yl)sulfonylphenyl]methyl]guanidine |
| SMILES | CN1CCN(S(=O)(=O)c2ccccc2C/N=C(\N)Nc2ccc3c(c2)CCC3)CC1 |
| InChI | InChI=1S/C22H29N5O2S/c1-26-11-13-27(14-12-26)30(28,29)21-8-3-2-5-19(21)16-24-22(23)25-20-10-9-17-6-4-7-18(17)15-20/h2-3,5,8-10,15H,4,6-7,11-14,16H2,1H3,(H3,23,24,25) |
| InChIKey | YXNZKSHMBCQVHY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 91.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|