C18H22N4O2S — CID 120581685
1-(2,3-dihydro-1H-inden-5-yl)-2-[(2-methyl-4-sulfamoylphenyl)methyl]guanidine (PubChem CID 120581685) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-2-[(2-methyl-4-sulfamoylphenyl)methyl]guanidine.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[(2-methyl-4-sulfamoylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 120581685 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[(2-methyl-4-sulfamoylphenyl)methyl]guanidine |
| SMILES | Cc1cc(S(N)(=O)=O)ccc1C/N=C(\N)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C18H22N4O2S/c1-12-9-17(25(20,23)24)8-6-15(12)11-21-18(19)22-16-7-5-13-3-2-4-14(13)10-16/h5-10H,2-4,11H2,1H3,(H3,19,21,22)(H2,20,23,24) |
| InChIKey | WRAOWGXUHLZAQU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|