C20H26N4O3S — CID 111072741
1-(2,3-dihydro-1H-inden-5-yl)-2-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]guanidine (PubChem CID 111072741) has the molecular formula C20H26N4O3S and a molecular weight of 402.52 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-2-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]guanidine.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111072741 |
| Molecular Formula | C20H26N4O3S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]guanidine |
| SMILES | COCCNS(=O)(=O)c1ccc(C/N=C(\N)Nc2ccc3c(c2)CCC3)cc1 |
| InChI | InChI=1S/C20H26N4O3S/c1-27-12-11-23-28(25,26)19-9-5-15(6-10-19)14-22-20(21)24-18-8-7-16-3-2-4-17(16)13-18/h5-10,13,23H,2-4,11-12,14H2,1H3,(H3,21,22,24) |
| InChIKey | LOFPCSWEKANJHD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|