C22H28N4O — CID 111072119
4-[[[amino-(2,3-dihydro-1H-inden-5-ylamino)methylidene]amino]methyl]-N-butan-2-ylbenzamide (PubChem CID 111072119) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is 4-[[[amino-(2,3-dihydro-1H-inden-5-ylamino)methylidene]amino]methyl]-N-butan-2-ylbenzamide.
| Compound Name | 4-[[[amino-(2,3-dihydro-1H-inden-5-ylamino)methylidene]amino]methyl]-N-butan-2-ylbenzamide |
|---|---|
| PubChem CID | 111072119 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 4-[[[amino-(2,3-dihydro-1H-inden-5-ylamino)methylidene]amino]methyl]-N-butan-2-ylbenzamide |
| SMILES | CCC(C)NC(=O)c1ccc(C/N=C(\N)Nc2ccc3c(c2)CCC3)cc1 |
| InChI | InChI=1S/C22H28N4O/c1-3-15(2)25-21(27)18-9-7-16(8-10-18)14-24-22(23)26-20-12-11-17-5-4-6-19(17)13-20/h7-13,15H,3-6,14H2,1-2H3,(H,25,27)(H3,23,24,26) |
| InChIKey | HLCYMAFPFCHZKL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|