C19H23IN4O2 — CID 111066304
methyl N-[4-[[[amino-(2,3-dihydro-1H-inden-5-ylamino)methylidene]amino]methyl]phenyl]carbamate;hydroiodide (PubChem CID 111066304) has the molecular formula C19H23IN4O2 and a molecular weight of 466.32 g/mol. Its IUPAC name is methyl N-[4-[[[amino-(2,3-dihydro-1H-inden-5-ylamino)methylidene]amino]methyl]phenyl]carbamate;hydroiodide.
| Compound Name | methyl N-[4-[[[amino-(2,3-dihydro-1H-inden-5-ylamino)methylidene]amino]methyl]phenyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111066304 |
| Molecular Formula | C19H23IN4O2 |
| Molecular Weight | 466.32 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | methyl N-[4-[[[amino-(2,3-dihydro-1H-inden-5-ylamino)methylidene]amino]methyl]phenyl]carbamate;hydroiodide |
| SMILES | COC(=O)Nc1ccc(C/N=C(\N)Nc2ccc3c(c2)CCC3)cc1.I |
| InChI | InChI=1S/C19H22N4O2.HI/c1-25-19(24)23-16-8-5-13(6-9-16)12-21-18(20)22-17-10-7-14-3-2-4-15(14)11-17;/h5-11H,2-4,12H2,1H3,(H,23,24)(H3,20,21,22);1H |
| InChIKey | ZYRMEAMEMTYLJU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.32 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|