C20H20N4S — CID 111046213
1-(2,3-dihydro-1H-inden-5-yl)-2-[(4-phenyl-1,3-thiazol-2-yl)methyl]guanidine (PubChem CID 111046213) has the molecular formula C20H20N4S and a molecular weight of 348.48 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-2-[(4-phenyl-1,3-thiazol-2-yl)methyl]guanidine.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[(4-phenyl-1,3-thiazol-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111046213 |
| Molecular Formula | C20H20N4S |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[(4-phenyl-1,3-thiazol-2-yl)methyl]guanidine |
| SMILES | N/C(=N\Cc1nc(-c2ccccc2)cs1)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C20H20N4S/c21-20(23-17-10-9-14-7-4-8-16(14)11-17)22-12-19-24-18(13-25-19)15-5-2-1-3-6-15/h1-3,5-6,9-11,13H,4,7-8,12H2,(H3,21,22,23) |
| InChIKey | TZDZPRCDWMTVGQ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|