C19H21N3S — CID 122096821
2-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-1-(2,3-dihydro-1H-inden-5-yl)guanidine (PubChem CID 122096821) has the molecular formula C19H21N3S and a molecular weight of 323.46 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-1-(2,3-dihydro-1H-inden-5-yl)guanidine.
| Compound Name | 2-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-1-(2,3-dihydro-1H-inden-5-yl)guanidine |
|---|---|
| PubChem CID | 122096821 |
| Molecular Formula | C19H21N3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 2-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-1-(2,3-dihydro-1H-inden-5-yl)guanidine |
| SMILES | N/C(=N\CC1CSc2ccccc21)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C19H21N3S/c20-19(22-16-9-8-13-4-3-5-14(13)10-16)21-11-15-12-23-18-7-2-1-6-17(15)18/h1-2,6-10,15H,3-5,11-12H2,(H3,20,21,22) |
| InChIKey | UGVDKHUTGHZRSO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|