C18H21N3S — CID 122096836
2-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-1-(2-phenylethyl)guanidine (PubChem CID 122096836) has the molecular formula C18H21N3S and a molecular weight of 311.45 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-1-(2-phenylethyl)guanidine.
| Compound Name | 2-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-1-(2-phenylethyl)guanidine |
|---|---|
| PubChem CID | 122096836 |
| Molecular Formula | C18H21N3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 2-(2,3-dihydro-1-benzothiophen-3-ylmethyl)-1-(2-phenylethyl)guanidine |
| SMILES | N/C(=N\CC1CSc2ccccc21)NCCc1ccccc1 |
| InChI | InChI=1S/C18H21N3S/c19-18(20-11-10-14-6-2-1-3-7-14)21-12-15-13-22-17-9-5-4-8-16(15)17/h1-9,15H,10-13H2,(H3,19,20,21) |
| InChIKey | CDFXCZXTCXTTQL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|