C14H19N3S2 — CID 122096825
N'-(2,3-dihydro-1-benzothiophen-3-ylmethyl)thiomorpholine-4-carboximidamide (PubChem CID 122096825) has the molecular formula C14H19N3S2 and a molecular weight of 293.46 g/mol. Its IUPAC name is N'-(2,3-dihydro-1-benzothiophen-3-ylmethyl)thiomorpholine-4-carboximidamide.
| Compound Name | N'-(2,3-dihydro-1-benzothiophen-3-ylmethyl)thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 122096825 |
| Molecular Formula | C14H19N3S2 |
| Molecular Weight | 293.46 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | N'-(2,3-dihydro-1-benzothiophen-3-ylmethyl)thiomorpholine-4-carboximidamide |
| SMILES | N/C(=N\CC1CSc2ccccc21)N1CCSCC1 |
| InChI | InChI=1S/C14H19N3S2/c15-14(17-5-7-18-8-6-17)16-9-11-10-19-13-4-2-1-3-12(11)13/h1-4,11H,5-10H2,(H2,15,16) |
| InChIKey | IIRAECSFAJKVDL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.46 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|