C17H27IN4S2 — CID 120513742
N'-[(4-benzylthiomorpholin-3-yl)methyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 120513742) has the molecular formula C17H27IN4S2 and a molecular weight of 478.47 g/mol. Its IUPAC name is N'-[(4-benzylthiomorpholin-3-yl)methyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[(4-benzylthiomorpholin-3-yl)methyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 120513742 |
| Molecular Formula | C17H27IN4S2 |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.07 |
| IUPAC Name | N'-[(4-benzylthiomorpholin-3-yl)methyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CC1CSCCN1Cc1ccccc1)N1CCSCC1 |
| InChI | InChI=1S/C17H26N4S2.HI/c18-17(20-6-9-22-10-7-20)19-12-16-14-23-11-8-21(16)13-15-4-2-1-3-5-15;/h1-5,16H,6-14H2,(H2,18,19);1H |
| InChIKey | XDUPJVJNWGAZTL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|