C19H24IN3OS — CID 111047747
N'-[(3-phenylmethoxyphenyl)methyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 111047747) has the molecular formula C19H24IN3OS and a molecular weight of 469.39 g/mol. Its IUPAC name is N'-[(3-phenylmethoxyphenyl)methyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[(3-phenylmethoxyphenyl)methyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111047747 |
| Molecular Formula | C19H24IN3OS |
| Molecular Weight | 469.39 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | N'-[(3-phenylmethoxyphenyl)methyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\Cc1cccc(OCc2ccccc2)c1)N1CCSCC1 |
| InChI | InChI=1S/C19H23N3OS.HI/c20-19(22-9-11-24-12-10-22)21-14-17-7-4-8-18(13-17)23-15-16-5-2-1-3-6-16;/h1-8,13H,9-12,14-15H2,(H2,20,21);1H |
| InChIKey | RSADRXNUHVGZGO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|