C17H26IN3O2S — CID 110028879
benzyl 5-[[amino(thiomorpholin-4-yl)methylidene]amino]pentanoate;hydroiodide (PubChem CID 110028879) has the molecular formula C17H26IN3O2S and a molecular weight of 463.39 g/mol. Its IUPAC name is benzyl 5-[[amino(thiomorpholin-4-yl)methylidene]amino]pentanoate;hydroiodide.
| Compound Name | benzyl 5-[[amino(thiomorpholin-4-yl)methylidene]amino]pentanoate;hydroiodide |
|---|---|
| PubChem CID | 110028879 |
| Molecular Formula | C17H26IN3O2S |
| Molecular Weight | 463.39 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | benzyl 5-[[amino(thiomorpholin-4-yl)methylidene]amino]pentanoate;hydroiodide |
| SMILES | I.N/C(=N\CCCCC(=O)OCc1ccccc1)N1CCSCC1 |
| InChI | InChI=1S/C17H25N3O2S.HI/c18-17(20-10-12-23-13-11-20)19-9-5-4-8-16(21)22-14-15-6-2-1-3-7-15;/h1-3,6-7H,4-5,8-14H2,(H2,18,19);1H |
| InChIKey | GPUVLWRPLSORNS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|