C16H23N5OS — CID 75533054
1-[3-[[[amino(thiomorpholin-4-yl)methylidene]amino]methyl]phenyl]-3-cyclopropylurea (PubChem CID 75533054) has the molecular formula C16H23N5OS and a molecular weight of 333.46 g/mol. Its IUPAC name is 1-[3-[[[amino(thiomorpholin-4-yl)methylidene]amino]methyl]phenyl]-3-cyclopropylurea.
| Compound Name | 1-[3-[[[amino(thiomorpholin-4-yl)methylidene]amino]methyl]phenyl]-3-cyclopropylurea |
|---|---|
| PubChem CID | 75533054 |
| Molecular Formula | C16H23N5OS |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 1-[3-[[[amino(thiomorpholin-4-yl)methylidene]amino]methyl]phenyl]-3-cyclopropylurea |
| SMILES | N/C(=N\Cc1cccc(NC(=O)NC2CC2)c1)N1CCSCC1 |
| InChI | InChI=1S/C16H23N5OS/c17-15(21-6-8-23-9-7-21)18-11-12-2-1-3-14(10-12)20-16(22)19-13-4-5-13/h1-3,10,13H,4-9,11H2,(H2,17,18)(H2,19,20,22) |
| InChIKey | AWFVKVBNKMGUMU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|