C13H17FN4OS — CID 111089441
2-[[amino(thiomorpholin-4-yl)methylidene]amino]-N-(3-fluorophenyl)acetamide (PubChem CID 111089441) has the molecular formula C13H17FN4OS and a molecular weight of 296.37 g/mol. Its IUPAC name is 2-[[amino(thiomorpholin-4-yl)methylidene]amino]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[[amino(thiomorpholin-4-yl)methylidene]amino]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 111089441 |
| Molecular Formula | C13H17FN4OS |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 2-[[amino(thiomorpholin-4-yl)methylidene]amino]-N-(3-fluorophenyl)acetamide |
| SMILES | N/C(=N\CC(=O)Nc1cccc(F)c1)N1CCSCC1 |
| InChI | InChI=1S/C13H17FN4OS/c14-10-2-1-3-11(8-10)17-12(19)9-16-13(15)18-4-6-20-7-5-18/h1-3,8H,4-7,9H2,(H2,15,16)(H,17,19) |
| InChIKey | FAYRNVWYKMURNW-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|