C18H19FN4O — CID 111089429
2-[[amino-(2,3-dihydro-1H-inden-5-ylamino)methylidene]amino]-N-(3-fluorophenyl)acetamide (PubChem CID 111089429) has the molecular formula C18H19FN4O and a molecular weight of 326.38 g/mol. Its IUPAC name is 2-[[amino-(2,3-dihydro-1H-inden-5-ylamino)methylidene]amino]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[[amino-(2,3-dihydro-1H-inden-5-ylamino)methylidene]amino]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 111089429 |
| Molecular Formula | C18H19FN4O |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 2-[[amino-(2,3-dihydro-1H-inden-5-ylamino)methylidene]amino]-N-(3-fluorophenyl)acetamide |
| SMILES | N/C(=N\CC(=O)Nc1cccc(F)c1)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C18H19FN4O/c19-14-5-2-6-15(10-14)22-17(24)11-21-18(20)23-16-8-7-12-3-1-4-13(12)9-16/h2,5-10H,1,3-4,11H2,(H,22,24)(H3,20,21,23) |
| InChIKey | GBGRPXVUZIKRSG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|