C22H25IN6O — CID 111077114
N-[3-[[[amino-(2,3-dihydro-1H-inden-5-ylamino)methylidene]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide;hydroiodide (PubChem CID 111077114) has the molecular formula C22H25IN6O and a molecular weight of 516.39 g/mol. Its IUPAC name is N-[3-[[[amino-(2,3-dihydro-1H-inden-5-ylamino)methylidene]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide;hydroiodide.
| Compound Name | N-[3-[[[amino-(2,3-dihydro-1H-inden-5-ylamino)methylidene]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111077114 |
| Molecular Formula | C22H25IN6O |
| Molecular Weight | 516.39 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | N-[3-[[[amino-(2,3-dihydro-1H-inden-5-ylamino)methylidene]amino]methyl]phenyl]-2-pyrazol-1-ylacetamide;hydroiodide |
| SMILES | I.N/C(=N\Cc1cccc(NC(=O)Cn2cccn2)c1)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C22H24N6O.HI/c23-22(27-20-9-8-17-5-2-6-18(17)13-20)24-14-16-4-1-7-19(12-16)26-21(29)15-28-11-3-10-25-28;/h1,3-4,7-13H,2,5-6,14-15H2,(H,26,29)(H3,23,24,27);1H |
| InChIKey | OLDRJLHFTYJXJL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|