C16H22IN5 — CID 120973408
1-(2,3-dihydro-1H-inden-5-yl)-2-[(1-ethylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 120973408) has the molecular formula C16H22IN5 and a molecular weight of 411.29 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-2-[(1-ethylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[(1-ethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 120973408 |
| Molecular Formula | C16H22IN5 |
| Molecular Weight | 411.29 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[(1-ethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCn1cc(C/N=C(\N)Nc2ccc3c(c2)CCC3)cn1.I |
| InChI | InChI=1S/C16H21N5.HI/c1-2-21-11-12(10-19-21)9-18-16(17)20-15-7-6-13-4-3-5-14(13)8-15;/h6-8,10-11H,2-5,9H2,1H3,(H3,17,18,20);1H |
| InChIKey | XEHOFRHXBVBLST-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|