C15H21IN6 — CID 111065935
1-(2,3-dihydro-1H-inden-5-yl)-2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111065935) has the molecular formula C15H21IN6 and a molecular weight of 412.28 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111065935 |
| Molecular Formula | C15H21IN6 |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[(4-ethyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCn1cnnc1C/N=C(\N)Nc1ccc2c(c1)CCC2.I |
| InChI | InChI=1S/C15H20N6.HI/c1-2-21-10-18-20-14(21)9-17-15(16)19-13-7-6-11-4-3-5-12(11)8-13;/h6-8,10H,2-5,9H2,1H3,(H3,16,17,19);1H |
| InChIKey | QUAKREJPVHPFEG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|