C23H29IN4O — CID 111075180
N-[3-[[[amino-(2,3-dihydro-1H-inden-5-ylamino)methylidene]amino]methyl]phenyl]cyclopentanecarboxamide;hydroiodide (PubChem CID 111075180) has the molecular formula C23H29IN4O and a molecular weight of 504.42 g/mol. Its IUPAC name is N-[3-[[[amino-(2,3-dihydro-1H-inden-5-ylamino)methylidene]amino]methyl]phenyl]cyclopentanecarboxamide;hydroiodide.
| Compound Name | N-[3-[[[amino-(2,3-dihydro-1H-inden-5-ylamino)methylidene]amino]methyl]phenyl]cyclopentanecarboxamide;hydroiodide |
|---|---|
| PubChem CID | 111075180 |
| Molecular Formula | C23H29IN4O |
| Molecular Weight | 504.42 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | N-[3-[[[amino-(2,3-dihydro-1H-inden-5-ylamino)methylidene]amino]methyl]phenyl]cyclopentanecarboxamide;hydroiodide |
| SMILES | I.N/C(=N\Cc1cccc(NC(=O)C2CCCC2)c1)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C23H28N4O.HI/c24-23(27-21-12-11-17-8-4-9-19(17)14-21)25-15-16-5-3-10-20(13-16)26-22(28)18-6-1-2-7-18;/h3,5,10-14,18H,1-2,4,6-9,15H2,(H,26,28)(H3,24,25,27);1H |
| InChIKey | RZRGRXOUXXONHZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.42 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|