C12H18IN5OS — CID 111093005
2-[[amino(thiomorpholin-4-yl)methylidene]amino]-N-pyridin-3-ylacetamide;hydroiodide (PubChem CID 111093005) has the molecular formula C12H18IN5OS and a molecular weight of 407.28 g/mol. Its IUPAC name is 2-[[amino(thiomorpholin-4-yl)methylidene]amino]-N-pyridin-3-ylacetamide;hydroiodide.
| Compound Name | 2-[[amino(thiomorpholin-4-yl)methylidene]amino]-N-pyridin-3-ylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111093005 |
| Molecular Formula | C12H18IN5OS |
| Molecular Weight | 407.28 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | 2-[[amino(thiomorpholin-4-yl)methylidene]amino]-N-pyridin-3-ylacetamide;hydroiodide |
| SMILES | I.N/C(=N\CC(=O)Nc1cccnc1)N1CCSCC1 |
| InChI | InChI=1S/C12H17N5OS.HI/c13-12(17-4-6-19-7-5-17)15-9-11(18)16-10-2-1-3-14-8-10;/h1-3,8H,4-7,9H2,(H2,13,15)(H,16,18);1H |
| InChIKey | ZROJHFOUMPEBNT-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 83.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.28 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|