C13H20IN5O — CID 119121150
2-[[amino-(cyclopentylamino)methylidene]amino]-N-pyridin-3-ylacetamide;hydroiodide (PubChem CID 119121150) has the molecular formula C13H20IN5O and a molecular weight of 389.24 g/mol. Its IUPAC name is 2-[[amino-(cyclopentylamino)methylidene]amino]-N-pyridin-3-ylacetamide;hydroiodide.
| Compound Name | 2-[[amino-(cyclopentylamino)methylidene]amino]-N-pyridin-3-ylacetamide;hydroiodide |
|---|---|
| PubChem CID | 119121150 |
| Molecular Formula | C13H20IN5O |
| Molecular Weight | 389.24 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 2-[[amino-(cyclopentylamino)methylidene]amino]-N-pyridin-3-ylacetamide;hydroiodide |
| SMILES | I.N/C(=N\CC(=O)Nc1cccnc1)NC1CCCC1 |
| InChI | InChI=1S/C13H19N5O.HI/c14-13(18-10-4-1-2-5-10)16-9-12(19)17-11-6-3-7-15-8-11;/h3,6-8,10H,1-2,4-5,9H2,(H,17,19)(H3,14,16,18);1H |
| InChIKey | FDADMQVGUKXQRJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|