C12H20IN5O2 — CID 111093023
2-[[amino-(1-methoxypropan-2-ylamino)methylidene]amino]-N-pyridin-3-ylacetamide;hydroiodide (PubChem CID 111093023) has the molecular formula C12H20IN5O2 and a molecular weight of 393.23 g/mol. Its IUPAC name is 2-[[amino-(1-methoxypropan-2-ylamino)methylidene]amino]-N-pyridin-3-ylacetamide;hydroiodide.
| Compound Name | 2-[[amino-(1-methoxypropan-2-ylamino)methylidene]amino]-N-pyridin-3-ylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111093023 |
| Molecular Formula | C12H20IN5O2 |
| Molecular Weight | 393.23 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 2-[[amino-(1-methoxypropan-2-ylamino)methylidene]amino]-N-pyridin-3-ylacetamide;hydroiodide |
| SMILES | COCC(C)N/C(N)=N/CC(=O)Nc1cccnc1.I |
| InChI | InChI=1S/C12H19N5O2.HI/c1-9(8-19-2)16-12(13)15-7-11(18)17-10-4-3-5-14-6-10;/h3-6,9H,7-8H2,1-2H3,(H,17,18)(H3,13,15,16);1H |
| InChIKey | LVAWXYKSSIVKCH-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.23 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|