C18H26FN5O3 — CID 111089435
tert-butyl 4-[N'-[2-(3-fluoroanilino)-2-oxoethyl]carbamimidoyl]piperazine-1-carboxylate (PubChem CID 111089435) has the molecular formula C18H26FN5O3 and a molecular weight of 379.44 g/mol. Its IUPAC name is tert-butyl 4-[N'-[2-(3-fluoroanilino)-2-oxoethyl]carbamimidoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[N'-[2-(3-fluoroanilino)-2-oxoethyl]carbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111089435 |
| Molecular Formula | C18H26FN5O3 |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | tert-butyl 4-[N'-[2-(3-fluoroanilino)-2-oxoethyl]carbamimidoyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(/C(N)=N/CC(=O)Nc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C18H26FN5O3/c1-18(2,3)27-17(26)24-9-7-23(8-10-24)16(20)21-12-15(25)22-14-6-4-5-13(19)11-14/h4-6,11H,7-10,12H2,1-3H3,(H2,20,21)(H,22,25) |
| InChIKey | VBLXLCAOXUXXSX-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 100.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|