C15H22FN3O4S — CID 126508345
tert-butyl 4-[(3-fluorophenyl)sulfamoyl]piperazine-1-carboxylate (PubChem CID 126508345) has the molecular formula C15H22FN3O4S and a molecular weight of 359.42 g/mol. Its IUPAC name is tert-butyl 4-[(3-fluorophenyl)sulfamoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3-fluorophenyl)sulfamoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 126508345 |
| Molecular Formula | C15H22FN3O4S |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | tert-butyl 4-[(3-fluorophenyl)sulfamoyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(S(=O)(=O)Nc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C15H22FN3O4S/c1-15(2,3)23-14(20)18-7-9-19(10-8-18)24(21,22)17-13-6-4-5-12(16)11-13/h4-6,11,17H,7-10H2,1-3H3 |
| InChIKey | MXZNXXGNDJWTPX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |