C17H25N3O3 — CID 166845071
tert-butyl 4-[3-(methylamino)benzoyl]piperazine-1-carboxylate (PubChem CID 166845071) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is tert-butyl 4-[3-(methylamino)benzoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(methylamino)benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 166845071 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | tert-butyl 4-[3-(methylamino)benzoyl]piperazine-1-carboxylate |
| SMILES | CNc1cccc(C(=O)N2CCN(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C17H25N3O3/c1-17(2,3)23-16(22)20-10-8-19(9-11-20)15(21)13-6-5-7-14(12-13)18-4/h5-7,12,18H,8-11H2,1-4H3 |
| InChIKey | BYDNZBGBYMCEGE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |