C18H24N2O5 — CID 67312875
tert-butyl 4-(3-acetyloxybenzoyl)piperazine-1-carboxylate (PubChem CID 67312875) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is tert-butyl 4-(3-acetyloxybenzoyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(3-acetyloxybenzoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 67312875 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | tert-butyl 4-(3-acetyloxybenzoyl)piperazine-1-carboxylate |
| SMILES | CC(=O)Oc1cccc(C(=O)N2CCN(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C18H24N2O5/c1-13(21)24-15-7-5-6-14(12-15)16(22)19-8-10-20(11-9-19)17(23)25-18(2,3)4/h5-7,12H,8-11H2,1-4H3 |
| InChIKey | SDVIFWWMJDXFBY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|