C21H28N2O4 — CID 108926900
[3-[4-[(E)-4,4-dimethylpent-2-enoyl]-1,4-diazepane-1-carbonyl]phenyl] acetate (PubChem CID 108926900) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is [3-[4-[(E)-4,4-dimethylpent-2-enoyl]-1,4-diazepane-1-carbonyl]phenyl] acetate.
| Compound Name | [3-[4-[(E)-4,4-dimethylpent-2-enoyl]-1,4-diazepane-1-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 108926900 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | [3-[4-[(E)-4,4-dimethylpent-2-enoyl]-1,4-diazepane-1-carbonyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)N2CCCN(C(=O)/C=C/C(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C21H28N2O4/c1-16(24)27-18-8-5-7-17(15-18)20(26)23-12-6-11-22(13-14-23)19(25)9-10-21(2,3)4/h5,7-10,15H,6,11-14H2,1-4H3/b10-9+ |
| InChIKey | IZRRPRFKTKETPP-MDZDMXLPSA-N |
| XLogP | 2.89 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|