C16H23FN4O5S — CID 155684708
tert-butyl 4-[(4-carbamoyl-2-fluorophenyl)sulfamoyl]piperazine-1-carboxylate (PubChem CID 155684708) has the molecular formula C16H23FN4O5S and a molecular weight of 402.45 g/mol. Its IUPAC name is tert-butyl 4-[(4-carbamoyl-2-fluorophenyl)sulfamoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-carbamoyl-2-fluorophenyl)sulfamoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 155684708 |
| Molecular Formula | C16H23FN4O5S |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | tert-butyl 4-[(4-carbamoyl-2-fluorophenyl)sulfamoyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(S(=O)(=O)Nc2ccc(C(N)=O)cc2F)CC1 |
| InChI | InChI=1S/C16H23FN4O5S/c1-16(2,3)26-15(23)20-6-8-21(9-7-20)27(24,25)19-13-5-4-11(14(18)22)10-12(13)17/h4-5,10,19H,6-9H2,1-3H3,(H2,18,22) |
| InChIKey | RBDVUKQCCJQRGN-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |