C16H23FN4O2 — CID 154546000
tert-butyl 4-(5-carbamimidoyl-2-fluorophenyl)piperazine-1-carboxylate (PubChem CID 154546000) has the molecular formula C16H23FN4O2 and a molecular weight of 322.38 g/mol. Its IUPAC name is tert-butyl 4-(5-carbamimidoyl-2-fluorophenyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-carbamimidoyl-2-fluorophenyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 154546000 |
| Molecular Formula | C16H23FN4O2 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | tert-butyl 4-(5-carbamimidoyl-2-fluorophenyl)piperazine-1-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc(F)c(N2CCN(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C16H23FN4O2/c1-16(2,3)23-15(22)21-8-6-20(7-9-21)13-10-11(14(18)19)4-5-12(13)17/h4-5,10H,6-9H2,1-3H3,(H3,18,19) |
| InChIKey | JHCGMEQFZUZLII-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 82.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|