C17H20N4O2S — CID 111040394
N-[4-[[[amino(thiomorpholin-4-yl)methylidene]amino]methyl]phenyl]furan-2-carboxamide (PubChem CID 111040394) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is N-[4-[[[amino(thiomorpholin-4-yl)methylidene]amino]methyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[[[amino(thiomorpholin-4-yl)methylidene]amino]methyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 111040394 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | N-[4-[[[amino(thiomorpholin-4-yl)methylidene]amino]methyl]phenyl]furan-2-carboxamide |
| SMILES | N/C(=N\Cc1ccc(NC(=O)c2ccco2)cc1)N1CCSCC1 |
| InChI | InChI=1S/C17H20N4O2S/c18-17(21-7-10-24-11-8-21)19-12-13-3-5-14(6-4-13)20-16(22)15-2-1-9-23-15/h1-6,9H,7-8,10-12H2,(H2,18,19)(H,20,22) |
| InChIKey | IMUPALVOLMHNLB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 83.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|