C23H26N4O4 — CID 111040354
N-[4-[[[amino-[2-(3,4-dimethoxyphenyl)ethylamino]methylidene]amino]methyl]phenyl]furan-2-carboxamide (PubChem CID 111040354) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is N-[4-[[[amino-[2-(3,4-dimethoxyphenyl)ethylamino]methylidene]amino]methyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[[[amino-[2-(3,4-dimethoxyphenyl)ethylamino]methylidene]amino]methyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 111040354 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | N-[4-[[[amino-[2-(3,4-dimethoxyphenyl)ethylamino]methylidene]amino]methyl]phenyl]furan-2-carboxamide |
| SMILES | COc1ccc(CCN/C(N)=N/Cc2ccc(NC(=O)c3ccco3)cc2)cc1OC |
| InChI | InChI=1S/C23H26N4O4/c1-29-19-10-7-16(14-21(19)30-2)11-12-25-23(24)26-15-17-5-8-18(9-6-17)27-22(28)20-4-3-13-31-20/h3-10,13-14H,11-12,15H2,1-2H3,(H,27,28)(H3,24,25,26) |
| InChIKey | VKHPOQKDJZZLFY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|