C22H25IN4O4 — CID 111046782
N-[3-[[[amino-[(3,4-dimethoxyphenyl)methylamino]methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide (PubChem CID 111046782) has the molecular formula C22H25IN4O4 and a molecular weight of 536.37 g/mol. Its IUPAC name is N-[3-[[[amino-[(3,4-dimethoxyphenyl)methylamino]methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[[amino-[(3,4-dimethoxyphenyl)methylamino]methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111046782 |
| Molecular Formula | C22H25IN4O4 |
| Molecular Weight | 536.37 g/mol |
| Exact Mass | 536.09 |
| IUPAC Name | N-[3-[[[amino-[(3,4-dimethoxyphenyl)methylamino]methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
| SMILES | COc1ccc(CN/C(N)=N/Cc2cccc(NC(=O)c3ccco3)c2)cc1OC.I |
| InChI | InChI=1S/C22H24N4O4.HI/c1-28-18-9-8-16(12-20(18)29-2)14-25-22(23)24-13-15-5-3-6-17(11-15)26-21(27)19-7-4-10-30-19;/h3-12H,13-14H2,1-2H3,(H,26,27)(H3,23,24,25);1H |
| InChIKey | AJHWWJMQQQTTNO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|