C22H23N3O5 — CID 32521036
N-[4-[2-(3,4-dimethoxyphenyl)ethylcarbamoylamino]phenyl]furan-2-carboxamide (PubChem CID 32521036) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is N-[4-[2-(3,4-dimethoxyphenyl)ethylcarbamoylamino]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[2-(3,4-dimethoxyphenyl)ethylcarbamoylamino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 32521036 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N-[4-[2-(3,4-dimethoxyphenyl)ethylcarbamoylamino]phenyl]furan-2-carboxamide |
| SMILES | COc1ccc(CCNC(=O)Nc2ccc(NC(=O)c3ccco3)cc2)cc1OC |
| InChI | InChI=1S/C22H23N3O5/c1-28-18-10-5-15(14-20(18)29-2)11-12-23-22(27)25-17-8-6-16(7-9-17)24-21(26)19-4-3-13-30-19/h3-10,13-14H,11-12H2,1-2H3,(H,24,26)(H2,23,25,27) |
| InChIKey | VPYCVMZKSGXEJG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 101.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |