C18H20N2O5 — CID 108891296
4-[2-(3,4-dimethoxyphenyl)ethylcarbamoylamino]benzoic acid (PubChem CID 108891296) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is 4-[2-(3,4-dimethoxyphenyl)ethylcarbamoylamino]benzoic acid.
| Compound Name | 4-[2-(3,4-dimethoxyphenyl)ethylcarbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 108891296 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 4-[2-(3,4-dimethoxyphenyl)ethylcarbamoylamino]benzoic acid |
| SMILES | COc1ccc(CCNC(=O)Nc2ccc(C(=O)O)cc2)cc1OC |
| InChI | InChI=1S/C18H20N2O5/c1-24-15-8-3-12(11-16(15)25-2)9-10-19-18(23)20-14-6-4-13(5-7-14)17(21)22/h3-8,11H,9-10H2,1-2H3,(H,21,22)(H2,19,20,23) |
| InChIKey | XRJNJQAOGWXFKC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |