C19H22N2O5 — CID 108891353
4-[[2-(3,4-dimethoxyphenyl)ethylcarbamoylamino]methyl]benzoic acid (PubChem CID 108891353) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is 4-[[2-(3,4-dimethoxyphenyl)ethylcarbamoylamino]methyl]benzoic acid.
| Compound Name | 4-[[2-(3,4-dimethoxyphenyl)ethylcarbamoylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 108891353 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 4-[[2-(3,4-dimethoxyphenyl)ethylcarbamoylamino]methyl]benzoic acid |
| SMILES | COc1ccc(CCNC(=O)NCc2ccc(C(=O)O)cc2)cc1OC |
| InChI | InChI=1S/C19H22N2O5/c1-25-16-8-5-13(11-17(16)26-2)9-10-20-19(24)21-12-14-3-6-15(7-4-14)18(22)23/h3-8,11H,9-10,12H2,1-2H3,(H,22,23)(H2,20,21,24) |
| InChIKey | QZOFABWHGQFAKV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |