C15H23N3O4 — CID 108891394
N-[3-[2-(3,4-dimethoxyphenyl)ethylcarbamoylamino]propyl]formamide (PubChem CID 108891394) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is N-[3-[2-(3,4-dimethoxyphenyl)ethylcarbamoylamino]propyl]formamide.
| Compound Name | N-[3-[2-(3,4-dimethoxyphenyl)ethylcarbamoylamino]propyl]formamide |
|---|---|
| PubChem CID | 108891394 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | N-[3-[2-(3,4-dimethoxyphenyl)ethylcarbamoylamino]propyl]formamide |
| SMILES | COc1ccc(CCNC(=O)NCCCNC=O)cc1OC |
| InChI | InChI=1S/C15H23N3O4/c1-21-13-5-4-12(10-14(13)22-2)6-9-18-15(20)17-8-3-7-16-11-19/h4-5,10-11H,3,6-9H2,1-2H3,(H,16,19)(H2,17,18,20) |
| InChIKey | TYCOZLJDAFHDMK-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|