C21H24N4O3 — CID 108885476
1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2,3-dimethylquinoxalin-6-yl)urea (PubChem CID 108885476) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2,3-dimethylquinoxalin-6-yl)urea.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2,3-dimethylquinoxalin-6-yl)urea |
|---|---|
| PubChem CID | 108885476 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(2,3-dimethylquinoxalin-6-yl)urea |
| SMILES | COc1ccc(CCNC(=O)Nc2ccc3nc(C)c(C)nc3c2)cc1OC |
| InChI | InChI=1S/C21H24N4O3/c1-13-14(2)24-18-12-16(6-7-17(18)23-13)25-21(26)22-10-9-15-5-8-19(27-3)20(11-15)28-4/h5-8,11-12H,9-10H2,1-4H3,(H2,22,25,26) |
| InChIKey | NTQJZXFVWYVNFG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |