C14H15N3O5 — CID 971429
1-(3,4-dimethoxyphenyl)-3-(furan-2-carbonylamino)urea (PubChem CID 971429) has the molecular formula C14H15N3O5 and a molecular weight of 305.29 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-(furan-2-carbonylamino)urea.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-(furan-2-carbonylamino)urea |
|---|---|
| PubChem CID | 971429 |
| Molecular Formula | C14H15N3O5 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-(furan-2-carbonylamino)urea |
| SMILES | COc1ccc(NC(=O)NNC(=O)c2ccco2)cc1OC |
| InChI | InChI=1S/C14H15N3O5/c1-20-10-6-5-9(8-12(10)21-2)15-14(19)17-16-13(18)11-4-3-7-22-11/h3-8H,1-2H3,(H,16,18)(H2,15,17,19) |
| InChIKey | SRVSYRFYHRQVFW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 101.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|