C16H17N3O6 — CID 4905370
2-[[5-(furan-2-carbonylamino)-2-methoxyphenyl]carbamoylamino]propanoic acid (PubChem CID 4905370) has the molecular formula C16H17N3O6 and a molecular weight of 347.33 g/mol. Its IUPAC name is 2-[[5-(furan-2-carbonylamino)-2-methoxyphenyl]carbamoylamino]propanoic acid.
| Compound Name | 2-[[5-(furan-2-carbonylamino)-2-methoxyphenyl]carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 4905370 |
| Molecular Formula | C16H17N3O6 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 2-[[5-(furan-2-carbonylamino)-2-methoxyphenyl]carbamoylamino]propanoic acid |
| SMILES | COc1ccc(NC(=O)c2ccco2)cc1NC(=O)NC(C)C(=O)O |
| InChI | InChI=1S/C16H17N3O6/c1-9(15(21)22)17-16(23)19-11-8-10(5-6-12(11)24-2)18-14(20)13-4-3-7-25-13/h3-9H,1-2H3,(H,18,20)(H,21,22)(H2,17,19,23) |
| InChIKey | ZQLYGDRBYNPKER-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 129.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |