C15H18N2O5 — CID 168593134
N-[5-(2,3-dihydroxypropylamino)-2-methoxyphenyl]furan-2-carboxamide (PubChem CID 168593134) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is N-[5-(2,3-dihydroxypropylamino)-2-methoxyphenyl]furan-2-carboxamide.
| Compound Name | N-[5-(2,3-dihydroxypropylamino)-2-methoxyphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 168593134 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | N-[5-(2,3-dihydroxypropylamino)-2-methoxyphenyl]furan-2-carboxamide |
| SMILES | COc1ccc(NCC(O)CO)cc1NC(=O)c1ccco1 |
| InChI | InChI=1S/C15H18N2O5/c1-21-13-5-4-10(16-8-11(19)9-18)7-12(13)17-15(20)14-3-2-6-22-14/h2-7,11,16,18-19H,8-9H2,1H3,(H,17,20) |
| InChIKey | PAKYQUYAXHUPKJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 103.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|