C15H18N2O4 — CID 108868367
1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(furan-2-yl)urea (PubChem CID 108868367) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(furan-2-yl)urea.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(furan-2-yl)urea |
|---|---|
| PubChem CID | 108868367 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-3-(furan-2-yl)urea |
| SMILES | COc1ccc(CCNC(=O)Nc2ccco2)cc1OC |
| InChI | InChI=1S/C15H18N2O4/c1-19-12-6-5-11(10-13(12)20-2)7-8-16-15(18)17-14-4-3-9-21-14/h3-6,9-10H,7-8H2,1-2H3,(H2,16,17,18) |
| InChIKey | DXYSCDVRBIBKKE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 72.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |