C11H22IN3S — CID 119118574
N'-(cyclopentylmethyl)thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 119118574) has the molecular formula C11H22IN3S and a molecular weight of 355.29 g/mol. Its IUPAC name is N'-(cyclopentylmethyl)thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-(cyclopentylmethyl)thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119118574 |
| Molecular Formula | C11H22IN3S |
| Molecular Weight | 355.29 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | N'-(cyclopentylmethyl)thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CC1CCCC1)N1CCSCC1 |
| InChI | InChI=1S/C11H21N3S.HI/c12-11(14-5-7-15-8-6-14)13-9-10-3-1-2-4-10;/h10H,1-9H2,(H2,12,13);1H |
| InChIKey | OHNZDDQBWZUWNI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|