C12H25N5S — CID 119147573
N'-[(1,4-dimethylpiperazin-2-yl)methyl]thiomorpholine-4-carboximidamide (PubChem CID 119147573) has the molecular formula C12H25N5S and a molecular weight of 271.43 g/mol. Its IUPAC name is N'-[(1,4-dimethylpiperazin-2-yl)methyl]thiomorpholine-4-carboximidamide.
| Compound Name | N'-[(1,4-dimethylpiperazin-2-yl)methyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 119147573 |
| Molecular Formula | C12H25N5S |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | N'-[(1,4-dimethylpiperazin-2-yl)methyl]thiomorpholine-4-carboximidamide |
| SMILES | CN1CCN(C)C(C/N=C(\N)N2CCSCC2)C1 |
| InChI | InChI=1S/C12H25N5S/c1-15-3-4-16(2)11(10-15)9-14-12(13)17-5-7-18-8-6-17/h11H,3-10H2,1-2H3,(H2,13,14) |
| InChIKey | BJTWWMFUTRLXSU-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 48.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|