C15H27N3S — CID 122096518
N'-[[(1R,2S)-2-cyclohexylcyclopropyl]methyl]thiomorpholine-4-carboximidamide (PubChem CID 122096518) has the molecular formula C15H27N3S and a molecular weight of 281.47 g/mol. Its IUPAC name is N'-[[(1R,2S)-2-cyclohexylcyclopropyl]methyl]thiomorpholine-4-carboximidamide.
| Compound Name | N'-[[(1R,2S)-2-cyclohexylcyclopropyl]methyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 122096518 |
| Molecular Formula | C15H27N3S |
| Molecular Weight | 281.47 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | N'-[[(1R,2S)-2-cyclohexylcyclopropyl]methyl]thiomorpholine-4-carboximidamide |
| SMILES | N/C(=N\C[C@@H]1C[C@H]1C1CCCCC1)N1CCSCC1 |
| InChI | InChI=1S/C15H27N3S/c16-15(18-6-8-19-9-7-18)17-11-13-10-14(13)12-4-2-1-3-5-12/h12-14H,1-11H2,(H2,16,17)/t13-,14-/m0/s1 |
| InChIKey | UKHUHOJETUQUGL-KBPBESRZSA-N |
| XLogP | 2.57 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.47 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|