C15H30N4S — CID 111056223
N'-[2-cyclohexyl-2-(dimethylamino)ethyl]thiomorpholine-4-carboximidamide (PubChem CID 111056223) has the molecular formula C15H30N4S and a molecular weight of 298.50 g/mol. Its IUPAC name is N'-[2-cyclohexyl-2-(dimethylamino)ethyl]thiomorpholine-4-carboximidamide.
| Compound Name | N'-[2-cyclohexyl-2-(dimethylamino)ethyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111056223 |
| Molecular Formula | C15H30N4S |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | N'-[2-cyclohexyl-2-(dimethylamino)ethyl]thiomorpholine-4-carboximidamide |
| SMILES | CN(C)C(C/N=C(\N)N1CCSCC1)C1CCCCC1 |
| InChI | InChI=1S/C15H30N4S/c1-18(2)14(13-6-4-3-5-7-13)12-17-15(16)19-8-10-20-11-9-19/h13-14H,3-12H2,1-2H3,(H2,16,17) |
| InChIKey | NAGQHFVOVOOCCD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|