C14H30N4S — CID 111042922
N'-[2-(dimethylamino)-3-ethylpentyl]thiomorpholine-4-carboximidamide (PubChem CID 111042922) has the molecular formula C14H30N4S and a molecular weight of 286.49 g/mol. Its IUPAC name is N'-[2-(dimethylamino)-3-ethylpentyl]thiomorpholine-4-carboximidamide.
| Compound Name | N'-[2-(dimethylamino)-3-ethylpentyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111042922 |
| Molecular Formula | C14H30N4S |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.22 |
| IUPAC Name | N'-[2-(dimethylamino)-3-ethylpentyl]thiomorpholine-4-carboximidamide |
| SMILES | CCC(CC)C(C/N=C(\N)N1CCSCC1)N(C)C |
| InChI | InChI=1S/C14H30N4S/c1-5-12(6-2)13(17(3)4)11-16-14(15)18-7-9-19-10-8-18/h12-13H,5-11H2,1-4H3,(H2,15,16) |
| InChIKey | BZZPMPJEDUHWHH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|