C15H27N3 — CID 122125675
N'-[[(1R,2S)-2-cyclobutylcyclopropyl]methyl]-3-methylpiperidine-1-carboximidamide (PubChem CID 122125675) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is N'-[[(1R,2S)-2-cyclobutylcyclopropyl]methyl]-3-methylpiperidine-1-carboximidamide.
| Compound Name | N'-[[(1R,2S)-2-cyclobutylcyclopropyl]methyl]-3-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 122125675 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | N'-[[(1R,2S)-2-cyclobutylcyclopropyl]methyl]-3-methylpiperidine-1-carboximidamide |
| SMILES | CC1CCCN(/C(N)=N/C[C@@H]2C[C@H]2C2CCC2)C1 |
| InChI | InChI=1S/C15H27N3/c1-11-4-3-7-18(10-11)15(16)17-9-13-8-14(13)12-5-2-6-12/h11-14H,2-10H2,1H3,(H2,16,17)/t11?,13-,14-/m0/s1 |
| InChIKey | SCQLMHGOZBQATF-VNXPTHQBSA-N |
| XLogP | 2.47 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|