C17H34IN3O — CID 111816125
N'-[(2-tert-butyloxan-3-yl)methyl]-3-methylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 111816125) has the molecular formula C17H34IN3O and a molecular weight of 423.38 g/mol. Its IUPAC name is N'-[(2-tert-butyloxan-3-yl)methyl]-3-methylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(2-tert-butyloxan-3-yl)methyl]-3-methylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111816125 |
| Molecular Formula | C17H34IN3O |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | N'-[(2-tert-butyloxan-3-yl)methyl]-3-methylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CC1CCCN(/C(N)=N/CC2CCCOC2C(C)(C)C)C1.I |
| InChI | InChI=1S/C17H33N3O.HI/c1-13-7-5-9-20(12-13)16(18)19-11-14-8-6-10-21-15(14)17(2,3)4;/h13-15H,5-12H2,1-4H3,(H2,18,19);1H |
| InChIKey | WWKXEOCBHHVBTR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|