C16H27N5O — CID 122099290
3-methyl-N'-[[(2R,3S)-2-(1-methylpyrazol-4-yl)oxolan-3-yl]methyl]piperidine-1-carboximidamide (PubChem CID 122099290) has the molecular formula C16H27N5O and a molecular weight of 305.43 g/mol. Its IUPAC name is 3-methyl-N'-[[(2R,3S)-2-(1-methylpyrazol-4-yl)oxolan-3-yl]methyl]piperidine-1-carboximidamide.
| Compound Name | 3-methyl-N'-[[(2R,3S)-2-(1-methylpyrazol-4-yl)oxolan-3-yl]methyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 122099290 |
| Molecular Formula | C16H27N5O |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | 3-methyl-N'-[[(2R,3S)-2-(1-methylpyrazol-4-yl)oxolan-3-yl]methyl]piperidine-1-carboximidamide |
| SMILES | CC1CCCN(/C(N)=N/C[C@@H]2CCO[C@H]2c2cnn(C)c2)C1 |
| InChI | InChI=1S/C16H27N5O/c1-12-4-3-6-21(10-12)16(17)18-8-13-5-7-22-15(13)14-9-19-20(2)11-14/h9,11-13,15H,3-8,10H2,1-2H3,(H2,17,18)/t12?,13-,15+/m0/s1 |
| InChIKey | PBAFOSQRRYYVLQ-RGPPAHDHSA-N |
| XLogP | 1.54 |
| TPSA | 68.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|