C16H19F2N5O — CID 122099299
1-(2,5-difluorophenyl)-2-[[(2R,3S)-2-(1-methylpyrazol-4-yl)oxolan-3-yl]methyl]guanidine (PubChem CID 122099299) has the molecular formula C16H19F2N5O and a molecular weight of 335.36 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-2-[[(2R,3S)-2-(1-methylpyrazol-4-yl)oxolan-3-yl]methyl]guanidine.
| Compound Name | 1-(2,5-difluorophenyl)-2-[[(2R,3S)-2-(1-methylpyrazol-4-yl)oxolan-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 122099299 |
| Molecular Formula | C16H19F2N5O |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 1-(2,5-difluorophenyl)-2-[[(2R,3S)-2-(1-methylpyrazol-4-yl)oxolan-3-yl]methyl]guanidine |
| SMILES | Cn1cc([C@@H]2OCC[C@H]2C/N=C(\N)Nc2cc(F)ccc2F)cn1 |
| InChI | InChI=1S/C16H19F2N5O/c1-23-9-11(8-21-23)15-10(4-5-24-15)7-20-16(19)22-14-6-12(17)2-3-13(14)18/h2-3,6,8-10,15H,4-5,7H2,1H3,(H3,19,20,22)/t10-,15+/m0/s1 |
| InChIKey | ULZKYRJRJCYRTA-ZUZCIYMTSA-N |
| XLogP | 2.20 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|